C20H22N4O9 — CID 78358292
N-[5-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-nitro-6-[2-(4-nitrophenyl)ethoxy]-2-pyridinyl]acetamide (PubChem CID 78358292) has the molecular formula C20H22N4O9 and a molecular weight of 462.42 g/mol. Its IUPAC name is N-[5-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-nitro-6-[2-(4-nitrophenyl)ethoxy]-2-pyridinyl]acetamide.
| Compound Name | N-[5-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-nitro-6-[2-(4-nitrophenyl)ethoxy]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 78358292 |
| Molecular Formula | C20H22N4O9 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-[5-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-nitro-6-[2-(4-nitrophenyl)ethoxy]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1nc(OCCc2ccc([N+](=O)[O-])cc2)c([C@H]2CC(O)[C@@H](CO)O2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N4O9/c1-11(26)21-19-15(24(30)31)8-14(17-9-16(27)18(10-25)33-17)20(22-19)32-7-6-12-2-4-13(5-3-12)23(28)29/h2-5,8,16-18,25,27H,6-7,9-10H2,1H3,(H,21,22,26)/t16?,17-,18-/m1/s1 |
| InChIKey | FOHXRMZLXNXZFZ-UKKPGEIXSA-N |
| XLogP | 1.66 |
| TPSA | 187.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|