C22H31N3O4 — CID 7836720
[2-[(2S)-2-ethylpiperidin-1-yl]-2-oxoethyl] 1-(phenylcarbamoyl)piperidine-4-carboxylate (PubChem CID 7836720) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is [2-[(2S)-2-ethylpiperidin-1-yl]-2-oxoethyl] 1-(phenylcarbamoyl)piperidine-4-carboxylate.
| Compound Name | [2-[(2S)-2-ethylpiperidin-1-yl]-2-oxoethyl] 1-(phenylcarbamoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7836720 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | [2-[(2S)-2-ethylpiperidin-1-yl]-2-oxoethyl] 1-(phenylcarbamoyl)piperidine-4-carboxylate |
| SMILES | CC[C@H]1CCCCN1C(=O)COC(=O)C1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C22H31N3O4/c1-2-19-10-6-7-13-25(19)20(26)16-29-21(27)17-11-14-24(15-12-17)22(28)23-18-8-4-3-5-9-18/h3-5,8-9,17,19H,2,6-7,10-16H2,1H3,(H,23,28)/t19-/m0/s1 |
| InChIKey | MLSWHSLANIMCDQ-IBGZPJMESA-N |
| XLogP | 3.26 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |