C24H26N2O5 — CID 78370483
1-(3-ethoxyphenyl)-7-methyl-2-(5-methyl-1,2-oxazol-3-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78370483) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)-7-methyl-2-(5-methyl-1,2-oxazol-3-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-ethoxyphenyl)-7-methyl-2-(5-methyl-1,2-oxazol-3-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78370483 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-(3-ethoxyphenyl)-7-methyl-2-(5-methyl-1,2-oxazol-3-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCOc1cccc(C2C3=C(OC4CCC(C)CC4C3=O)C(=O)N2c2cc(C)on2)c1 |
| InChI | InChI=1S/C24H26N2O5/c1-4-29-16-7-5-6-15(12-16)21-20-22(27)17-10-13(2)8-9-18(17)30-23(20)24(28)26(21)19-11-14(3)31-25-19/h5-7,11-13,17-18,21H,4,8-10H2,1-3H3 |
| InChIKey | YVWTYZNNALDCTP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |