C19H27N5O2S — CID 7837063
(2R)-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)propanamide (PubChem CID 7837063) has the molecular formula C19H27N5O2S and a molecular weight of 389.53 g/mol. Its IUPAC name is (2R)-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)propanamide.
| Compound Name | (2R)-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 7837063 |
| Molecular Formula | C19H27N5O2S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | (2R)-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)propanamide |
| SMILES | CCCn1c(S[C@H](C)C(=O)Nc2ccc(N3CCCCC3)cc2)n[nH]c1=O |
| InChI | InChI=1S/C19H27N5O2S/c1-3-11-24-18(26)21-22-19(24)27-14(2)17(25)20-15-7-9-16(10-8-15)23-12-5-4-6-13-23/h7-10,14H,3-6,11-13H2,1-2H3,(H,20,25)(H,21,26)/t14-/m1/s1 |
| InChIKey | UAIZZOCIRCDCMF-CQSZACIVSA-N |
| XLogP | 3.09 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|