C15H15F3N2OS — CID 78374647
2-sulfanylidene-3-[4-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-4-one (PubChem CID 78374647) has the molecular formula C15H15F3N2OS and a molecular weight of 328.36 g/mol. Its IUPAC name is 2-sulfanylidene-3-[4-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-4-one.
| Compound Name | 2-sulfanylidene-3-[4-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 78374647 |
| Molecular Formula | C15H15F3N2OS |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-sulfanylidene-3-[4-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-4-one |
| SMILES | O=C1C2CCCCC2NC(=S)N1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H15F3N2OS/c16-15(17,18)9-5-7-10(8-6-9)20-13(21)11-3-1-2-4-12(11)19-14(20)22/h5-8,11-12H,1-4H2,(H,19,22) |
| InChIKey | LWISTVDIGUCAOR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|