C23H24ClN5O2 — CID 78375684
2-[(3-chlorophenyl)methyl]-6-(3,5-dimethylphenyl)-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione (PubChem CID 78375684) has the molecular formula C23H24ClN5O2 and a molecular weight of 437.93 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-6-(3,5-dimethylphenyl)-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 2-[(3-chlorophenyl)methyl]-6-(3,5-dimethylphenyl)-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 78375684 |
| Molecular Formula | C23H24ClN5O2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-6-(3,5-dimethylphenyl)-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione |
| SMILES | Cc1cc(C)cc(N2CCN3C2=NC2C3C(=O)N(Cc3cccc(Cl)c3)C(=O)N2C)c1 |
| InChI | InChI=1S/C23H24ClN5O2/c1-14-9-15(2)11-18(10-14)27-7-8-28-19-20(25-22(27)28)26(3)23(31)29(21(19)30)13-16-5-4-6-17(24)12-16/h4-6,9-12,19-20H,7-8,13H2,1-3H3 |
| InChIKey | WNWARXIOFHUINI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |