C28H34N3O+ — CID 7837976
1-[(3S,3aR,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(4-methylpiperidin-1-ium-1-yl)ethanone (PubChem CID 7837976) has the molecular formula C28H34N3O+ and a molecular weight of 428.60 g/mol. Its IUPAC name is 1-[(3S,3aR,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(4-methylpiperidin-1-ium-1-yl)ethanone.
| Compound Name | 1-[(3S,3aR,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(4-methylpiperidin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 7837976 |
| Molecular Formula | C28H34N3O+ |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 1-[(3S,3aR,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(4-methylpiperidin-1-ium-1-yl)ethanone |
| SMILES | CC1CC[NH+](CC(=O)N2N=C3/C(=C/c4ccccc4)CCC[C@@H]3[C@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C28H33N3O/c1-21-15-17-30(18-16-21)20-26(32)31-28(23-11-6-3-7-12-23)25-14-8-13-24(27(25)29-31)19-22-9-4-2-5-10-22/h2-7,9-12,19,21,25,28H,8,13-18,20H2,1H3/p+1/b24-19+/t25-,28+/m0/s1 |
| InChIKey | BGWAFHYACKIQPE-LXNFEYCFSA-O |
| XLogP | 4.12 |
| TPSA | 37.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |