C24H21ClN6O3 — CID 78382028
1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[5-chloro-7-(1H-imidazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione (PubChem CID 78382028) has the molecular formula C24H21ClN6O3 and a molecular weight of 476.92 g/mol. Its IUPAC name is 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[5-chloro-7-(1H-imidazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[5-chloro-7-(1H-imidazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 78382028 |
| Molecular Formula | C24H21ClN6O3 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[5-chloro-7-(1H-imidazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione |
| SMILES | CC1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1c[nH]c2c(-c3ncc[nH]3)cc(Cl)nc12 |
| InChI | InChI=1S/C24H21ClN6O3/c1-14-13-30(23(33)15-5-3-2-4-6-15)9-10-31(14)24(34)21(32)17-12-28-19-16(22-26-7-8-27-22)11-18(25)29-20(17)19/h2-8,11-12,14,28H,9-10,13H2,1H3,(H,26,27) |
| InChIKey | NAGLQVPUDYIOPK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|