C20H20N2O5 — CID 78383493
4-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-2,3,3a,4,5,7a-hexahydro-1H-pyrano[2,3-c]pyrazol-6-one (PubChem CID 78383493) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-2,3,3a,4,5,7a-hexahydro-1H-pyrano[2,3-c]pyrazol-6-one.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-2,3,3a,4,5,7a-hexahydro-1H-pyrano[2,3-c]pyrazol-6-one |
|---|---|
| PubChem CID | 78383493 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)-2,3,3a,4,5,7a-hexahydro-1H-pyrano[2,3-c]pyrazol-6-one |
| SMILES | COc1ccc(C2NNC3OC(=O)CC(c4ccc5c(c4)OCO5)C32)cc1 |
| InChI | InChI=1S/C20H20N2O5/c1-24-13-5-2-11(3-6-13)19-18-14(9-17(23)27-20(18)22-21-19)12-4-7-15-16(8-12)26-10-25-15/h2-8,14,18-22H,9-10H2,1H3 |
| InChIKey | YNOJPGHOPSFELO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |