C20H34O2 — CID 78383919
18-methylnonadeca-8,11,14-trienoic acid (PubChem CID 78383919) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 18-methylnonadeca-8,11,14-trienoic acid.
| Compound Name | 18-methylnonadeca-8,11,14-trienoic acid |
|---|---|
| PubChem CID | 78383919 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 18-methylnonadeca-8,11,14-trienoic acid |
| SMILES | CC(C)CCC=CCC=CCC=CCCCCCCC(=O)O |
| InChI | InChI=1S/C20H34O2/c1-19(2)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20(21)22/h4-7,11,13,19H,3,8-10,12,14-18H2,1-2H3,(H,21,22) |
| InChIKey | RKNDDVGTINXHOO-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|