About 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-8-methoxychromen-2-one
7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-8-methoxychromen-2-one (PubChem CID 78384883) has the molecular formula C20H24O5
and a molecular weight of 344.41 g/mol. Its IUPAC name is 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-8-methoxychromen-2-one.
Molecular Properties
| Compound Name | 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-8-methoxychromen-2-one |
| PubChem CID | 78384883 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-8-methoxychromen-2-one |
| SMILES | COc1c(OCC=C(C)CCC2OC2(C)C)ccc2ccc(=O)oc12 |
| InChI | InChI=1S/C20H24O5/c1-13(5-9-16-20(2,3)25-16)11-12-23-15-8-6-14-7-10-17(21)24-18(14)19(15)22-4/h6-8,10-11,16H,5,9,12H2,1-4H3 |
| InChIKey | KZSNOTJYLLULDB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 61.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-8-methoxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-8-methoxychromen-2-one?
The IUPAC name of 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-8-methoxychromen-2-one (CID 78384883) is 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-8-methoxychromen-2-one.
What is the SMILES notation for 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-8-methoxychromen-2-one?
The canonical SMILES for 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-8-methoxychromen-2-one is COc1c(OCC=C(C)CCC2OC2(C)C)ccc2ccc(=O)oc12.
What is the InChIKey of 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-8-methoxychromen-2-one?
The InChIKey is KZSNOTJYLLULDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O5/c1-13(5-9-16-20(2,3)25-16)11-12-23-15-8-6-14-7-10-17(21)24-18(14)19(15)22-4/h6-8,10-11,16H,5,9,12H2,1-4H3.
What are the key properties of 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-8-methoxychromen-2-one?
7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-8-methoxychromen-2-one has a molecular weight of 344.41 g/mol, XLogP of 4.08, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-8-methoxychromen-2-one is sourced from PubChem (CID 78384883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).