C22H32O3 — CID 78385089
5-methyl-4-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzene-1,2,3-triol (PubChem CID 78385089) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is 5-methyl-4-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzene-1,2,3-triol.
| Compound Name | 5-methyl-4-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 78385089 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 5-methyl-4-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzene-1,2,3-triol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCc1c(C)cc(O)c(O)c1O |
| InChI | InChI=1S/C22H32O3/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-19-18(5)14-20(23)22(25)21(19)24/h8,10,12,14,23-25H,6-7,9,11,13H2,1-5H3 |
| InChIKey | BACDZNLMIXNCOG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|