C22H34O10 — CID 78385241
methyl 3-(2-methoxy-2-oxoethyl)-8a-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,3a,4,7,8-hexahydro-1H-azulene-6-carboxylate (PubChem CID 78385241) has the molecular formula C22H34O10 and a molecular weight of 458.50 g/mol. Its IUPAC name is methyl 3-(2-methoxy-2-oxoethyl)-8a-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,3a,4,7,8-hexahydro-1H-azulene-6-carboxylate.
| Compound Name | methyl 3-(2-methoxy-2-oxoethyl)-8a-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,3a,4,7,8-hexahydro-1H-azulene-6-carboxylate |
|---|---|
| PubChem CID | 78385241 |
| Molecular Formula | C22H34O10 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | methyl 3-(2-methoxy-2-oxoethyl)-8a-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,3a,4,7,8-hexahydro-1H-azulene-6-carboxylate |
| SMILES | COC(=O)CC1CC(OC2OC(CO)C(O)C(O)C2O)C2(C)CCC(C(=O)OC)=CCC12 |
| InChI | InChI=1S/C22H34O10/c1-22-7-6-11(20(28)30-3)4-5-13(22)12(9-16(24)29-2)8-15(22)32-21-19(27)18(26)17(25)14(10-23)31-21/h4,12-15,17-19,21,23,25-27H,5-10H2,1-3H3 |
| InChIKey | XPVYZIHUAHTXGV-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |