C18H13F3N2O3 — CID 7838840
[(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-(trifluoromethyl)benzoate (PubChem CID 7838840) has the molecular formula C18H13F3N2O3 and a molecular weight of 362.31 g/mol. Its IUPAC name is [(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-(trifluoromethyl)benzoate.
| Compound Name | [(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 7838840 |
| Molecular Formula | C18H13F3N2O3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | [(2R)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-(trifluoromethyl)benzoate |
| SMILES | C[C@@H](OC(=O)c1cccc(C(F)(F)F)c1)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C18H13F3N2O3/c1-11(16(24)23-15-7-2-4-12(8-15)10-22)26-17(25)13-5-3-6-14(9-13)18(19,20)21/h2-9,11H,1H3,(H,23,24)/t11-/m1/s1 |
| InChIKey | KGJSSJIVUJHXHQ-LLVKDONJSA-N |
| XLogP | 3.76 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |