C12H21N5O2 — CID 78389293
8-(dimethylamino)-4a,5,5a,6,7,8,9,9a,10,10a-decahydro-1H-benzo[g]pteridine-2,4-dione (PubChem CID 78389293) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 8-(dimethylamino)-4a,5,5a,6,7,8,9,9a,10,10a-decahydro-1H-benzo[g]pteridine-2,4-dione.
| Compound Name | 8-(dimethylamino)-4a,5,5a,6,7,8,9,9a,10,10a-decahydro-1H-benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 78389293 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 8-(dimethylamino)-4a,5,5a,6,7,8,9,9a,10,10a-decahydro-1H-benzo[g]pteridine-2,4-dione |
| SMILES | CN(C)C1CCC2NC3C(=O)NC(=O)NC3NC2C1 |
| InChI | InChI=1S/C12H21N5O2/c1-17(2)6-3-4-7-8(5-6)14-10-9(13-7)11(18)16-12(19)15-10/h6-10,13-14H,3-5H2,1-2H3,(H2,15,16,18,19) |
| InChIKey | LTAPTRIGSMOTEB-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |