About N-(3-butyl-2,4-dioxo-4aH-benzo[g]pteridin-8-yl)acetamide
N-(3-butyl-2,4-dioxo-4aH-benzo[g]pteridin-8-yl)acetamide (PubChem CID 78396466) has the molecular formula C16H17N5O3
and a molecular weight of 327.34 g/mol. Its IUPAC name is N-(3-butyl-2,4-dioxo-4aH-benzo[g]pteridin-8-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-butyl-2,4-dioxo-4aH-benzo[g]pteridin-8-yl)acetamide |
| PubChem CID | 78396466 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-(3-butyl-2,4-dioxo-4aH-benzo[g]pteridin-8-yl)acetamide |
| SMILES | CCCCN1C(=O)N=C2N=c3cc(NC(C)=O)ccc3=NC2C1=O |
| InChI | InChI=1S/C16H17N5O3/c1-3-4-7-21-15(23)13-14(20-16(21)24)19-12-8-10(17-9(2)22)5-6-11(12)18-13/h5-6,8,13H,3-4,7H2,1-2H3,(H,17,22) |
| InChIKey | GSGUOKVFRCLNMC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 103.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-butyl-2,4-dioxo-4aH-benzo[g]pteridin-8-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-butyl-2,4-dioxo-4aH-benzo[g]pteridin-8-yl)acetamide?
The IUPAC name of N-(3-butyl-2,4-dioxo-4aH-benzo[g]pteridin-8-yl)acetamide (CID 78396466) is N-(3-butyl-2,4-dioxo-4aH-benzo[g]pteridin-8-yl)acetamide.
What is the SMILES notation for N-(3-butyl-2,4-dioxo-4aH-benzo[g]pteridin-8-yl)acetamide?
The canonical SMILES for N-(3-butyl-2,4-dioxo-4aH-benzo[g]pteridin-8-yl)acetamide is CCCCN1C(=O)N=C2N=c3cc(NC(C)=O)ccc3=NC2C1=O.
What is the InChIKey of N-(3-butyl-2,4-dioxo-4aH-benzo[g]pteridin-8-yl)acetamide?
The InChIKey is GSGUOKVFRCLNMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5O3/c1-3-4-7-21-15(23)13-14(20-16(21)24)19-12-8-10(17-9(2)22)5-6-11(12)18-13/h5-6,8,13H,3-4,7H2,1-2H3,(H,17,22).
What are the key properties of N-(3-butyl-2,4-dioxo-4aH-benzo[g]pteridin-8-yl)acetamide?
N-(3-butyl-2,4-dioxo-4aH-benzo[g]pteridin-8-yl)acetamide has a molecular weight of 327.34 g/mol, XLogP of 0.43, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-butyl-2,4-dioxo-4aH-benzo[g]pteridin-8-yl)acetamide is sourced from PubChem (CID 78396466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).