About N-[(4-bromophenyl)methyl]-N',N'-diethyl-N-methylethane-1,2-diamine
N-[(4-bromophenyl)methyl]-N',N'-diethyl-N-methylethane-1,2-diamine (PubChem CID 784059) has the molecular formula C14H23BrN2
and a molecular weight of 299.26 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-N',N'-diethyl-N-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-[(4-bromophenyl)methyl]-N',N'-diethyl-N-methylethane-1,2-diamine |
| PubChem CID | 784059 |
| Molecular Formula | C14H23BrN2 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-N',N'-diethyl-N-methylethane-1,2-diamine |
| SMILES | CCN(CC)CCN(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H23BrN2/c1-4-17(5-2)11-10-16(3)12-13-6-8-14(15)9-7-13/h6-9H,4-5,10-12H2,1-3H3 |
| InChIKey | ZCULSVCFPSITPU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(4-bromophenyl)methyl]-N',N'-diethyl-N-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-bromophenyl)methyl]-N',N'-diethyl-N-methylethane-1,2-diamine?
The IUPAC name of N-[(4-bromophenyl)methyl]-N',N'-diethyl-N-methylethane-1,2-diamine (CID 784059) is N-[(4-bromophenyl)methyl]-N',N'-diethyl-N-methylethane-1,2-diamine.
What is the SMILES notation for N-[(4-bromophenyl)methyl]-N',N'-diethyl-N-methylethane-1,2-diamine?
The canonical SMILES for N-[(4-bromophenyl)methyl]-N',N'-diethyl-N-methylethane-1,2-diamine is CCN(CC)CCN(C)Cc1ccc(Br)cc1.
What is the InChIKey of N-[(4-bromophenyl)methyl]-N',N'-diethyl-N-methylethane-1,2-diamine?
The InChIKey is ZCULSVCFPSITPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23BrN2/c1-4-17(5-2)11-10-16(3)12-13-6-8-14(15)9-7-13/h6-9H,4-5,10-12H2,1-3H3.
What are the key properties of N-[(4-bromophenyl)methyl]-N',N'-diethyl-N-methylethane-1,2-diamine?
N-[(4-bromophenyl)methyl]-N',N'-diethyl-N-methylethane-1,2-diamine has a molecular weight of 299.26 g/mol, XLogP of 3.22, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-bromophenyl)methyl]-N',N'-diethyl-N-methylethane-1,2-diamine is sourced from PubChem (CID 784059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).