methyl 3,7,11-trimethyldodec-2-enoate

C16H30O2 — CID 78408961

IUPACmethyl 3,7,11-trimethyldodec-2-enoate
SMILESCOC(=O)C=C(C)CCCC(C)CCCC(C)C
InChIInChI=1S/C16H30O2/c1-13(2)8-6-9-14(3)10-7-11-15(4)12-16(17)18-5/h12-14H,6-11H2,1-5H3
InChIKeyVMWXOXCIPIMPLA-UHFFFAOYSA-N
MW254.41 g/mol
LogP4.74
Rot. Bonds9

About methyl 3,7,11-trimethyldodec-2-enoate

methyl 3,7,11-trimethyldodec-2-enoate (PubChem CID 78408961) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is methyl 3,7,11-trimethyldodec-2-enoate.

Molecular Properties

Compound Namemethyl 3,7,11-trimethyldodec-2-enoate
PubChem CID78408961
Molecular FormulaC16H30O2
Molecular Weight254.41 g/mol
Exact Mass254.22
IUPAC Namemethyl 3,7,11-trimethyldodec-2-enoate
SMILESCOC(=O)C=C(C)CCCC(C)CCCC(C)C
InChIInChI=1S/C16H30O2/c1-13(2)8-6-9-14(3)10-7-11-15(4)12-16(17)18-5/h12-14H,6-11H2,1-5H3
InChIKeyVMWXOXCIPIMPLA-UHFFFAOYSA-N
XLogP4.74
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.41
LogP ≤ 54.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 3,7,11-trimethyldodec-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,7,11-trimethyldodec-2-enoate?
The IUPAC name of methyl 3,7,11-trimethyldodec-2-enoate (CID 78408961) is methyl 3,7,11-trimethyldodec-2-enoate.
What is the SMILES notation for methyl 3,7,11-trimethyldodec-2-enoate?
The canonical SMILES for methyl 3,7,11-trimethyldodec-2-enoate is COC(=O)C=C(C)CCCC(C)CCCC(C)C.
What is the InChIKey of methyl 3,7,11-trimethyldodec-2-enoate?
The InChIKey is VMWXOXCIPIMPLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2/c1-13(2)8-6-9-14(3)10-7-11-15(4)12-16(17)18-5/h12-14H,6-11H2,1-5H3.
What are the key properties of methyl 3,7,11-trimethyldodec-2-enoate?
methyl 3,7,11-trimethyldodec-2-enoate has a molecular weight of 254.41 g/mol, XLogP of 4.74, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,7,11-trimethyldodec-2-enoate is sourced from PubChem (CID 78408961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).