About 1-(5-ethylidene-3,4-dihydro-2H-pyridin-6-yl)ethanone
1-(5-ethylidene-3,4-dihydro-2H-pyridin-6-yl)ethanone (PubChem CID 78409354) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-(5-ethylidene-3,4-dihydro-2H-pyridin-6-yl)ethanone.
Molecular Properties
| Compound Name | 1-(5-ethylidene-3,4-dihydro-2H-pyridin-6-yl)ethanone |
| PubChem CID | 78409354 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 1-(5-ethylidene-3,4-dihydro-2H-pyridin-6-yl)ethanone |
| SMILES | CC=C1CCCN=C1C(C)=O |
| InChI | InChI=1S/C9H13NO/c1-3-8-5-4-6-10-9(8)7(2)11/h3H,4-6H2,1-2H3 |
| InChIKey | GAEQLABCUJPAHA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-ethylidene-3,4-dihydro-2H-pyridin-6-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethylidene-3,4-dihydro-2H-pyridin-6-yl)ethanone?
The IUPAC name of 1-(5-ethylidene-3,4-dihydro-2H-pyridin-6-yl)ethanone (CID 78409354) is 1-(5-ethylidene-3,4-dihydro-2H-pyridin-6-yl)ethanone.
What is the SMILES notation for 1-(5-ethylidene-3,4-dihydro-2H-pyridin-6-yl)ethanone?
The canonical SMILES for 1-(5-ethylidene-3,4-dihydro-2H-pyridin-6-yl)ethanone is CC=C1CCCN=C1C(C)=O.
What is the InChIKey of 1-(5-ethylidene-3,4-dihydro-2H-pyridin-6-yl)ethanone?
The InChIKey is GAEQLABCUJPAHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-3-8-5-4-6-10-9(8)7(2)11/h3H,4-6H2,1-2H3.
What are the key properties of 1-(5-ethylidene-3,4-dihydro-2H-pyridin-6-yl)ethanone?
1-(5-ethylidene-3,4-dihydro-2H-pyridin-6-yl)ethanone has a molecular weight of 151.21 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethylidene-3,4-dihydro-2H-pyridin-6-yl)ethanone is sourced from PubChem (CID 78409354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).