C26H46O2Si2 — CID 78409509
trimethyl-[(10,13,17-trimethyl-3-trimethylsilyloxy-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)oxy]silane (PubChem CID 78409509) has the molecular formula C26H46O2Si2 and a molecular weight of 446.82 g/mol. Its IUPAC name is trimethyl-[(10,13,17-trimethyl-3-trimethylsilyloxy-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)oxy]silane.
| Compound Name | trimethyl-[(10,13,17-trimethyl-3-trimethylsilyloxy-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)oxy]silane |
|---|---|
| PubChem CID | 78409509 |
| Molecular Formula | C26H46O2Si2 |
| Molecular Weight | 446.82 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | trimethyl-[(10,13,17-trimethyl-3-trimethylsilyloxy-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)oxy]silane |
| SMILES | CC12CCC(O[Si](C)(C)C)=CC1=CCC1C2CCC2(C)C1CCC2(C)O[Si](C)(C)C |
| InChI | InChI=1S/C26H46O2Si2/c1-24-15-12-20(27-29(4,5)6)18-19(24)10-11-21-22(24)13-16-25(2)23(21)14-17-26(25,3)28-30(7,8)9/h10,18,21-23H,11-17H2,1-9H3 |
| InChIKey | GISBYVRBKWVVFE-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.82 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|