About [3-(3,3-dihydroxypropoxy)-1-hydroxypropyl] octadec-9-enoate
[3-(3,3-dihydroxypropoxy)-1-hydroxypropyl] octadec-9-enoate (PubChem CID 78410916) has the molecular formula C24H46O6
and a molecular weight of 430.63 g/mol. Its IUPAC name is [3-(3,3-dihydroxypropoxy)-1-hydroxypropyl] octadec-9-enoate.
Molecular Properties
| Compound Name | [3-(3,3-dihydroxypropoxy)-1-hydroxypropyl] octadec-9-enoate |
| PubChem CID | 78410916 |
| Molecular Formula | C24H46O6 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | [3-(3,3-dihydroxypropoxy)-1-hydroxypropyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC(O)CCOCCC(O)O |
| InChI | InChI=1S/C24H46O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(27)30-24(28)19-21-29-20-18-22(25)26/h9-10,22,24-26,28H,2-8,11-21H2,1H3 |
| InChIKey | PVTCPBFBMLIOTI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3-(3,3-dihydroxypropoxy)-1-hydroxypropyl] octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,3-dihydroxypropoxy)-1-hydroxypropyl] octadec-9-enoate?
The IUPAC name of [3-(3,3-dihydroxypropoxy)-1-hydroxypropyl] octadec-9-enoate (CID 78410916) is [3-(3,3-dihydroxypropoxy)-1-hydroxypropyl] octadec-9-enoate.
What is the SMILES notation for [3-(3,3-dihydroxypropoxy)-1-hydroxypropyl] octadec-9-enoate?
The canonical SMILES for [3-(3,3-dihydroxypropoxy)-1-hydroxypropyl] octadec-9-enoate is CCCCCCCCC=CCCCCCCCC(=O)OC(O)CCOCCC(O)O.
What is the InChIKey of [3-(3,3-dihydroxypropoxy)-1-hydroxypropyl] octadec-9-enoate?
The InChIKey is PVTCPBFBMLIOTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(27)30-24(28)19-21-29-20-18-22(25)26/h9-10,22,24-26,28H,2-8,11-21H2,1H3.
What are the key properties of [3-(3,3-dihydroxypropoxy)-1-hydroxypropyl] octadec-9-enoate?
[3-(3,3-dihydroxypropoxy)-1-hydroxypropyl] octadec-9-enoate has a molecular weight of 430.63 g/mol, XLogP of 4.99, 22 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,3-dihydroxypropoxy)-1-hydroxypropyl] octadec-9-enoate is sourced from PubChem (CID 78410916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).