C8H10O3 — CID 78411930
3-hydroxy-2-prop-1-enyl-2,3-dihydropyran-6-one (PubChem CID 78411930) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 3-hydroxy-2-prop-1-enyl-2,3-dihydropyran-6-one.
| Compound Name | 3-hydroxy-2-prop-1-enyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 78411930 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 3-hydroxy-2-prop-1-enyl-2,3-dihydropyran-6-one |
| SMILES | CC=CC1OC(=O)C=CC1O |
| InChI | InChI=1S/C8H10O3/c1-2-3-7-6(9)4-5-8(10)11-7/h2-7,9H,1H3 |
| InChIKey | OKDRUMBNXIYUEO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|