C22H26FN5O3 — CID 78413702
2-(3,3-dimethyl-2-oxobutyl)-6-(2-fluorophenyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione (PubChem CID 78413702) has the molecular formula C22H26FN5O3 and a molecular weight of 427.48 g/mol. Its IUPAC name is 2-(3,3-dimethyl-2-oxobutyl)-6-(2-fluorophenyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 2-(3,3-dimethyl-2-oxobutyl)-6-(2-fluorophenyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 78413702 |
| Molecular Formula | C22H26FN5O3 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2-(3,3-dimethyl-2-oxobutyl)-6-(2-fluorophenyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione |
| SMILES | CC1=C(C)N2C(=NC3C2C(=O)N(CC(=O)C(C)(C)C)C(=O)N3C)N1c1ccccc1F |
| InChI | InChI=1S/C22H26FN5O3/c1-12-13(2)28-17-18(24-20(28)27(12)15-10-8-7-9-14(15)23)25(6)21(31)26(19(17)30)11-16(29)22(3,4)5/h7-10,17-18H,11H2,1-6H3 |
| InChIKey | GNLBNWIQEVPASC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |