About N-(2-chlorophenyl)-N-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide
N-(2-chlorophenyl)-N-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide (PubChem CID 78419058) has the molecular formula C16H16ClNO3
and a molecular weight of 305.76 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide.
Molecular Properties
| Compound Name | N-(2-chlorophenyl)-N-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide |
| PubChem CID | 78419058 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-(2-chlorophenyl)-N-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide |
| SMILES | CN(C(=O)C1C2CC3OC(=O)C1C3C2)c1ccccc1Cl |
| InChI | InChI=1S/C16H16ClNO3/c1-18(11-5-3-2-4-10(11)17)15(19)13-8-6-9-12(7-8)21-16(20)14(9)13/h2-5,8-9,12-14H,6-7H2,1H3 |
| InChIKey | QTPGCWBXXVAEOL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-chlorophenyl)-N-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorophenyl)-N-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide?
The IUPAC name of N-(2-chlorophenyl)-N-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide (CID 78419058) is N-(2-chlorophenyl)-N-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide.
What is the SMILES notation for N-(2-chlorophenyl)-N-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide?
The canonical SMILES for N-(2-chlorophenyl)-N-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide is CN(C(=O)C1C2CC3OC(=O)C1C3C2)c1ccccc1Cl.
What is the InChIKey of N-(2-chlorophenyl)-N-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide?
The InChIKey is QTPGCWBXXVAEOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClNO3/c1-18(11-5-3-2-4-10(11)17)15(19)13-8-6-9-12(7-8)21-16(20)14(9)13/h2-5,8-9,12-14H,6-7H2,1H3.
What are the key properties of N-(2-chlorophenyl)-N-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide?
N-(2-chlorophenyl)-N-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide has a molecular weight of 305.76 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorophenyl)-N-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide is sourced from PubChem (CID 78419058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).