About [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(2-fluorophenoxy)acetate
[2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(2-fluorophenoxy)acetate (PubChem CID 7842163) has the molecular formula C19H17FN2O3S
and a molecular weight of 372.42 g/mol. Its IUPAC name is [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(2-fluorophenoxy)acetate.
Molecular Properties
| Compound Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(2-fluorophenoxy)acetate |
| PubChem CID | 7842163 |
| Molecular Formula | C19H17FN2O3S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(2-fluorophenoxy)acetate |
| SMILES | Cc1ccc(Nc2nc(COC(=O)COc3ccccc3F)cs2)cc1 |
| InChI | InChI=1S/C19H17FN2O3S/c1-13-6-8-14(9-7-13)21-19-22-15(12-26-19)10-25-18(23)11-24-17-5-3-2-4-16(17)20/h2-9,12H,10-11H2,1H3,(H,21,22) |
| InChIKey | OLFGMXHQNDKNRC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(2-fluorophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(2-fluorophenoxy)acetate?
The IUPAC name of [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(2-fluorophenoxy)acetate (CID 7842163) is [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(2-fluorophenoxy)acetate.
What is the SMILES notation for [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(2-fluorophenoxy)acetate?
The canonical SMILES for [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(2-fluorophenoxy)acetate is Cc1ccc(Nc2nc(COC(=O)COc3ccccc3F)cs2)cc1.
What is the InChIKey of [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(2-fluorophenoxy)acetate?
The InChIKey is OLFGMXHQNDKNRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN2O3S/c1-13-6-8-14(9-7-13)21-19-22-15(12-26-19)10-25-18(23)11-24-17-5-3-2-4-16(17)20/h2-9,12H,10-11H2,1H3,(H,21,22).
What are the key properties of [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(2-fluorophenoxy)acetate?
[2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(2-fluorophenoxy)acetate has a molecular weight of 372.42 g/mol, XLogP of 4.46, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 2-(2-fluorophenoxy)acetate is sourced from PubChem (CID 7842163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).