C20H36N6O3S — CID 78421832
N-[1-[[5-(diaminomethylamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-4-methylpentanamide (PubChem CID 78421832) has the molecular formula C20H36N6O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is N-[1-[[5-(diaminomethylamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-4-methylpentanamide.
| Compound Name | N-[1-[[5-(diaminomethylamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 78421832 |
| Molecular Formula | C20H36N6O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | N-[1-[[5-(diaminomethylamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)NC(C(=O)NC(CCCNC(N)N)C(=O)c1nccs1)C(C)C |
| InChI | InChI=1S/C20H36N6O3S/c1-12(2)7-8-15(27)26-16(13(3)4)18(29)25-14(6-5-9-24-20(21)22)17(28)19-23-10-11-30-19/h10-14,16,20,24H,5-9,21-22H2,1-4H3,(H,25,29)(H,26,27) |
| InChIKey | ZXELQWLUDMEUHS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 152.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|