About (5-Chloro-2-nitrobenzyl)(3,4-difluorophenyl)amine
(5-Chloro-2-nitrobenzyl)(3,4-difluorophenyl)amine (PubChem CID 784221) has the molecular formula C13H9ClF2N2O2
and a molecular weight of 298.67 g/mol. Its IUPAC name is N-[(5-chloro-2-nitrophenyl)methyl]-3,4-difluoroaniline.
Molecular Properties
| Compound Name | (5-Chloro-2-nitrobenzyl)(3,4-difluorophenyl)amine |
| PubChem CID | 784221 |
| Molecular Formula | C13H9ClF2N2O2 |
| Molecular Weight | 298.67 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | N-[(5-chloro-2-nitrophenyl)methyl]-3,4-difluoroaniline |
| SMILES | C1=CC(=C(C=C1NCC2=C(C=CC(=C2)Cl)[N+](=O)[O-])F)F |
| InChI | InChI=1S/C13H9ClF2N2O2/c14-9-1-4-13(18(19)20)8(5-9)7-17-10-2-3-11(15)12(16)6-10/h1-6,17H,7H2 |
| InChIKey | OKWKUHCNDYJOAV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 57.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | 343 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.67 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-Chloro-2-nitrobenzyl)(3,4-difluorophenyl)amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-Chloro-2-nitrobenzyl)(3,4-difluorophenyl)amine?
The IUPAC name of (5-Chloro-2-nitrobenzyl)(3,4-difluorophenyl)amine (CID 784221) is N-[(5-chloro-2-nitrophenyl)methyl]-3,4-difluoroaniline.
What is the SMILES notation for (5-Chloro-2-nitrobenzyl)(3,4-difluorophenyl)amine?
The canonical SMILES for (5-Chloro-2-nitrobenzyl)(3,4-difluorophenyl)amine is C1=CC(=C(C=C1NCC2=C(C=CC(=C2)Cl)[N+](=O)[O-])F)F.
What is the InChIKey of (5-Chloro-2-nitrobenzyl)(3,4-difluorophenyl)amine?
The InChIKey is OKWKUHCNDYJOAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClF2N2O2/c14-9-1-4-13(18(19)20)8(5-9)7-17-10-2-3-11(15)12(16)6-10/h1-6,17H,7H2.
What are the key properties of (5-Chloro-2-nitrobenzyl)(3,4-difluorophenyl)amine?
(5-Chloro-2-nitrobenzyl)(3,4-difluorophenyl)amine has a molecular weight of 298.67 g/mol, XLogP of 4.10, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-Chloro-2-nitrobenzyl)(3,4-difluorophenyl)amine is sourced from PubChem (CID 784221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).