C15H13N4O2- — CID 78425619
4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxylate (PubChem CID 78425619) has the molecular formula C15H13N4O2- and a molecular weight of 281.30 g/mol. Its IUPAC name is 4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxylate.
| Compound Name | 4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxylate |
|---|---|
| PubChem CID | 78425619 |
| Molecular Formula | C15H13N4O2- |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4,5-dicyano-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxylate |
| SMILES | CC12CCC(C(=O)[O-])(c3nc(C#N)c(C#N)nc31)C2(C)C |
| InChI | InChI=1S/C15H14N4O2/c1-13(2)14(3)4-5-15(13,12(20)21)11-10(14)18-8(6-16)9(7-17)19-11/h4-5H2,1-3H3,(H,20,21)/p-1 |
| InChIKey | JXHJMPFFKUCDFI-UHFFFAOYSA-M |
| XLogP | 0.30 |
| TPSA | 113.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |