C16H20NO5S- — CID 78425646
4-[(3-ethoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoate (PubChem CID 78425646) has the molecular formula C16H20NO5S- and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-[(3-ethoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoate.
| Compound Name | 4-[(3-ethoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 78425646 |
| Molecular Formula | C16H20NO5S- |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 4-[(3-ethoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoate |
| SMILES | CCOC(=O)c1c(NC(=O)CCC(=O)[O-])sc2c1CCC(C)C2 |
| InChI | InChI=1S/C16H21NO5S/c1-3-22-16(21)14-10-5-4-9(2)8-11(10)23-15(14)17-12(18)6-7-13(19)20/h9H,3-8H2,1-2H3,(H,17,18)(H,19,20)/p-1 |
| InChIKey | YQBOXYLARGFHPN-UHFFFAOYSA-M |
| XLogP | 1.52 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'} |
|---|