C29H23F2N9O — CID 78425849
6-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-2-N,4-N-dipyridin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 78425849) has the molecular formula C29H23F2N9O and a molecular weight of 551.56 g/mol. Its IUPAC name is 6-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-2-N,4-N-dipyridin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-2-N,4-N-dipyridin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 78425849 |
| Molecular Formula | C29H23F2N9O |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | 6-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-2-N,4-N-dipyridin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CCOc1cc(F)c(Cn2nc(-c3nc(Nc4ccncc4)nc(Nc4ccncc4)n3)c3ccccc32)c(F)c1 |
| InChI | InChI=1S/C29H23F2N9O/c1-2-41-20-15-23(30)22(24(31)16-20)17-40-25-6-4-3-5-21(25)26(39-40)27-36-28(34-18-7-11-32-12-8-18)38-29(37-27)35-19-9-13-33-14-10-19/h3-16H,2,17H2,1H3,(H2,32,33,34,35,36,37,38) |
| InChIKey | UXJCOUNVVVHUKU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |