C14H24O4S — CID 78426029
[(3S,3aR,6S,6aS)-6-butylsulfanyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] butanoate (PubChem CID 78426029) has the molecular formula C14H24O4S and a molecular weight of 288.41 g/mol. Its IUPAC name is [(3S,3aR,6S,6aS)-6-butylsulfanyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] butanoate.
| Compound Name | [(3S,3aR,6S,6aS)-6-butylsulfanyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] butanoate |
|---|---|
| PubChem CID | 78426029 |
| Molecular Formula | C14H24O4S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [(3S,3aR,6S,6aS)-6-butylsulfanyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] butanoate |
| SMILES | CCCCS[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2OC(=O)CCC |
| InChI | InChI=1S/C14H24O4S/c1-3-5-7-19-11-9-17-13-10(8-16-14(11)13)18-12(15)6-4-2/h10-11,13-14H,3-9H2,1-2H3/t10-,11-,13+,14+/m0/s1 |
| InChIKey | IHQOGODSDIMBML-CDGCEXEKSA-N |
| XLogP | 2.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|