About 1-cyclohexyl-2-(4H-imidazo[1,5-a]indol-4-yl)ethanol
1-cyclohexyl-2-(4H-imidazo[1,5-a]indol-4-yl)ethanol (PubChem CID 78426054) has the molecular formula C18H22N2O
and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-cyclohexyl-2-(4H-imidazo[1,5-a]indol-4-yl)ethanol.
Molecular Properties
| Compound Name | 1-cyclohexyl-2-(4H-imidazo[1,5-a]indol-4-yl)ethanol |
| PubChem CID | 78426054 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-cyclohexyl-2-(4H-imidazo[1,5-a]indol-4-yl)ethanol |
| SMILES | OC(CC1c2ccccc2-n2cncc21)C1CCCCC1 |
| InChI | InChI=1S/C18H22N2O/c21-18(13-6-2-1-3-7-13)10-15-14-8-4-5-9-16(14)20-12-19-11-17(15)20/h4-5,8-9,11-13,15,18,21H,1-3,6-7,10H2 |
| InChIKey | MENMLCRHDMAGQE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexyl-2-(4H-imidazo[1,5-a]indol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2-(4H-imidazo[1,5-a]indol-4-yl)ethanol?
The IUPAC name of 1-cyclohexyl-2-(4H-imidazo[1,5-a]indol-4-yl)ethanol (CID 78426054) is 1-cyclohexyl-2-(4H-imidazo[1,5-a]indol-4-yl)ethanol.
What is the SMILES notation for 1-cyclohexyl-2-(4H-imidazo[1,5-a]indol-4-yl)ethanol?
The canonical SMILES for 1-cyclohexyl-2-(4H-imidazo[1,5-a]indol-4-yl)ethanol is OC(CC1c2ccccc2-n2cncc21)C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2-(4H-imidazo[1,5-a]indol-4-yl)ethanol?
The InChIKey is MENMLCRHDMAGQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O/c21-18(13-6-2-1-3-7-13)10-15-14-8-4-5-9-16(14)20-12-19-11-17(15)20/h4-5,8-9,11-13,15,18,21H,1-3,6-7,10H2.
What are the key properties of 1-cyclohexyl-2-(4H-imidazo[1,5-a]indol-4-yl)ethanol?
1-cyclohexyl-2-(4H-imidazo[1,5-a]indol-4-yl)ethanol has a molecular weight of 282.39 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2-(4H-imidazo[1,5-a]indol-4-yl)ethanol is sourced from PubChem (CID 78426054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).