About N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine
N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 78426116) has the molecular formula C21H14N4O2S
and a molecular weight of 386.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine |
| PubChem CID | 78426116 |
| Molecular Formula | C21H14N4O2S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | c1ccc2sc(-c3cnc4ccc(Nc5ccc6c(c5)OCO6)nn34)cc2c1 |
| InChI | InChI=1S/C21H14N4O2S/c1-2-4-18-13(3-1)9-19(28-18)15-11-22-21-8-7-20(24-25(15)21)23-14-5-6-16-17(10-14)27-12-26-16/h1-11H,12H2,(H,23,24) |
| InChIKey | ZDKYLSZHDIAWRH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine?
The IUPAC name of N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine (CID 78426116) is N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine.
What is the SMILES notation for N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine?
The canonical SMILES for N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine is c1ccc2sc(-c3cnc4ccc(Nc5ccc6c(c5)OCO6)nn34)cc2c1.
What is the InChIKey of N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine?
The InChIKey is ZDKYLSZHDIAWRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14N4O2S/c1-2-4-18-13(3-1)9-19(28-18)15-11-22-21-8-7-20(24-25(15)21)23-14-5-6-16-17(10-14)27-12-26-16/h1-11H,12H2,(H,23,24).
What are the key properties of N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine?
N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine has a molecular weight of 386.44 g/mol, XLogP of 5.08, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine is sourced from PubChem (CID 78426116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).