C11H14O3 — CID 78426242
(1E,5E)-5-methyl-9-oxocyclonona-1,5-diene-1-carboxylic acid (PubChem CID 78426242) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (1E,5E)-5-methyl-9-oxocyclonona-1,5-diene-1-carboxylic acid.
| Compound Name | (1E,5E)-5-methyl-9-oxocyclonona-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 78426242 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (1E,5E)-5-methyl-9-oxocyclonona-1,5-diene-1-carboxylic acid |
| SMILES | C/C1=C\CCC(=O)/C(C(=O)O)=C/CC1 |
| InChI | InChI=1S/C11H14O3/c1-8-4-2-6-9(11(13)14)10(12)7-3-5-8/h5-6H,2-4,7H2,1H3,(H,13,14)/b8-5+,9-6- |
| InChIKey | KBDLHAMXKCDYMS-OWNHSFIXSA-N |
| XLogP | 2.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|