C25H23N5O2S — CID 78426269
3-(1-benzothiophen-2-yl)-8-N-cyclopropyl-6-N-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazine-6,8-diamine (PubChem CID 78426269) has the molecular formula C25H23N5O2S and a molecular weight of 457.56 g/mol. Its IUPAC name is 3-(1-benzothiophen-2-yl)-8-N-cyclopropyl-6-N-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazine-6,8-diamine.
| Compound Name | 3-(1-benzothiophen-2-yl)-8-N-cyclopropyl-6-N-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazine-6,8-diamine |
|---|---|
| PubChem CID | 78426269 |
| Molecular Formula | C25H23N5O2S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 3-(1-benzothiophen-2-yl)-8-N-cyclopropyl-6-N-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazine-6,8-diamine |
| SMILES | COc1ccc(Nc2cc(NC3CC3)c3ncc(-c4cc5ccccc5s4)n3n2)cc1OC |
| InChI | InChI=1S/C25H23N5O2S/c1-31-20-10-9-17(12-21(20)32-2)28-24-13-18(27-16-7-8-16)25-26-14-19(30(25)29-24)23-11-15-5-3-4-6-22(15)33-23/h3-6,9-14,16,27H,7-8H2,1-2H3,(H,28,29) |
| InChIKey | LLIAMOPBNYETPE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 72.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|