C33H34N4O3 — CID 78426403
9-benzyl-2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(3,3-dimethylpiperidine-1-carbonyl)carbazole-4-carboxamide (PubChem CID 78426403) has the molecular formula C33H34N4O3 and a molecular weight of 534.66 g/mol. Its IUPAC name is 9-benzyl-2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(3,3-dimethylpiperidine-1-carbonyl)carbazole-4-carboxamide.
| Compound Name | 9-benzyl-2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(3,3-dimethylpiperidine-1-carbonyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 78426403 |
| Molecular Formula | C33H34N4O3 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 9-benzyl-2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(3,3-dimethylpiperidine-1-carbonyl)carbazole-4-carboxamide |
| SMILES | Cc1noc(C)c1-c1cc(C(N)=O)c2c3cc(C(=O)N4CCCC(C)(C)C4)ccc3n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C33H34N4O3/c1-20-29(21(2)40-35-20)24-16-26(31(34)38)30-25-15-23(32(39)36-14-8-13-33(3,4)19-36)11-12-27(25)37(28(30)17-24)18-22-9-6-5-7-10-22/h5-7,9-12,15-17H,8,13-14,18-19H2,1-4H3,(H2,34,38) |
| InChIKey | ZJBONGFPCPJVNN-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|