C32H32N4O3 — CID 78426404
9-benzyl-2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(2-methylpiperidine-1-carbonyl)carbazole-4-carboxamide (PubChem CID 78426404) has the molecular formula C32H32N4O3 and a molecular weight of 520.63 g/mol. Its IUPAC name is 9-benzyl-2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(2-methylpiperidine-1-carbonyl)carbazole-4-carboxamide.
| Compound Name | 9-benzyl-2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(2-methylpiperidine-1-carbonyl)carbazole-4-carboxamide |
|---|---|
| PubChem CID | 78426404 |
| Molecular Formula | C32H32N4O3 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 9-benzyl-2-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(2-methylpiperidine-1-carbonyl)carbazole-4-carboxamide |
| SMILES | Cc1noc(C)c1-c1cc(C(N)=O)c2c3cc(C(=O)N4CCCCC4C)ccc3n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C32H32N4O3/c1-19-9-7-8-14-35(19)32(38)23-12-13-27-25(15-23)30-26(31(33)37)16-24(29-20(2)34-39-21(29)3)17-28(30)36(27)18-22-10-5-4-6-11-22/h4-6,10-13,15-17,19H,7-9,14,18H2,1-3H3,(H2,33,37) |
| InChIKey | VDGBZAUCONLKDW-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|