C11H16F2N4O7S — CID 78426588
[(2S,5S)-4,4-difluoro-7-oxo-2-(pyrrolidin-3-yloxycarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 78426588) has the molecular formula C11H16F2N4O7S and a molecular weight of 386.33 g/mol. Its IUPAC name is [(2S,5S)-4,4-difluoro-7-oxo-2-(pyrrolidin-3-yloxycarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5S)-4,4-difluoro-7-oxo-2-(pyrrolidin-3-yloxycarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 78426588 |
| Molecular Formula | C11H16F2N4O7S |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | [(2S,5S)-4,4-difluoro-7-oxo-2-(pyrrolidin-3-yloxycarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NOC1CCNC1)[C@@H]1CC(F)(F)[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C11H16F2N4O7S/c12-11(13)3-7(9(18)15-23-6-1-2-14-4-6)16-5-8(11)17(10(16)19)24-25(20,21)22/h6-8,14H,1-5H2,(H,15,18)(H,20,21,22)/t6?,7-,8-/m0/s1 |
| InChIKey | QCSBRTVSJSRWPU-ALKRTJFJSA-N |
| XLogP | -1.36 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|