About 6-(7-cyano-2,2-dimethyl-3H-1-benzofuran-5-yl)pyridine-3-carboxylic acid
6-(7-cyano-2,2-dimethyl-3H-1-benzofuran-5-yl)pyridine-3-carboxylic acid (PubChem CID 78426795) has the molecular formula C17H14N2O3
and a molecular weight of 294.31 g/mol. Its IUPAC name is 6-(7-cyano-2,2-dimethyl-3H-1-benzofuran-5-yl)pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-(7-cyano-2,2-dimethyl-3H-1-benzofuran-5-yl)pyridine-3-carboxylic acid |
| PubChem CID | 78426795 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 6-(7-cyano-2,2-dimethyl-3H-1-benzofuran-5-yl)pyridine-3-carboxylic acid |
| SMILES | CC1(C)Cc2cc(-c3ccc(C(=O)O)cn3)cc(C#N)c2O1 |
| InChI | InChI=1S/C17H14N2O3/c1-17(2)7-12-5-11(6-13(8-18)15(12)22-17)14-4-3-10(9-19-14)16(20)21/h3-6,9H,7H2,1-2H3,(H,20,21) |
| InChIKey | CLNDYDPGBZICMG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(7-cyano-2,2-dimethyl-3H-1-benzofuran-5-yl)pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(7-cyano-2,2-dimethyl-3H-1-benzofuran-5-yl)pyridine-3-carboxylic acid?
The IUPAC name of 6-(7-cyano-2,2-dimethyl-3H-1-benzofuran-5-yl)pyridine-3-carboxylic acid (CID 78426795) is 6-(7-cyano-2,2-dimethyl-3H-1-benzofuran-5-yl)pyridine-3-carboxylic acid.
What is the SMILES notation for 6-(7-cyano-2,2-dimethyl-3H-1-benzofuran-5-yl)pyridine-3-carboxylic acid?
The canonical SMILES for 6-(7-cyano-2,2-dimethyl-3H-1-benzofuran-5-yl)pyridine-3-carboxylic acid is CC1(C)Cc2cc(-c3ccc(C(=O)O)cn3)cc(C#N)c2O1.
What is the InChIKey of 6-(7-cyano-2,2-dimethyl-3H-1-benzofuran-5-yl)pyridine-3-carboxylic acid?
The InChIKey is CLNDYDPGBZICMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O3/c1-17(2)7-12-5-11(6-13(8-18)15(12)22-17)14-4-3-10(9-19-14)16(20)21/h3-6,9H,7H2,1-2H3,(H,20,21).
What are the key properties of 6-(7-cyano-2,2-dimethyl-3H-1-benzofuran-5-yl)pyridine-3-carboxylic acid?
6-(7-cyano-2,2-dimethyl-3H-1-benzofuran-5-yl)pyridine-3-carboxylic acid has a molecular weight of 294.31 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(7-cyano-2,2-dimethyl-3H-1-benzofuran-5-yl)pyridine-3-carboxylic acid is sourced from PubChem (CID 78426795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).