C10H16N4O7S — CID 78426887
[(2S,5R)-2-[[acetyl(methyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 78426887) has the molecular formula C10H16N4O7S and a molecular weight of 336.33 g/mol. Its IUPAC name is [(2S,5R)-2-[[acetyl(methyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[[acetyl(methyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 78426887 |
| Molecular Formula | C10H16N4O7S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | [(2S,5R)-2-[[acetyl(methyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CC(=O)N(C)NC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C10H16N4O7S/c1-6(15)12(2)11-9(16)8-4-3-7-5-13(8)10(17)14(7)21-22(18,19)20/h7-8H,3-5H2,1-2H3,(H,11,16)(H,18,19,20)/t7-,8+/m1/s1 |
| InChIKey | UEXGZFQHGZBWMJ-SFYZADRCSA-N |
| XLogP | -1.50 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|