C25H29NO3 — CID 78427205
3-[4-[benzyl(methyl)amino]butoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 78427205) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is 3-[4-[benzyl(methyl)amino]butoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 3-[4-[benzyl(methyl)amino]butoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 78427205 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 3-[4-[benzyl(methyl)amino]butoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | CN(CCCCOc1ccc2c3c(c(=O)oc2c1)CCCC3)Cc1ccccc1 |
| InChI | InChI=1S/C25H29NO3/c1-26(18-19-9-3-2-4-10-19)15-7-8-16-28-20-13-14-22-21-11-5-6-12-23(21)25(27)29-24(22)17-20/h2-4,9-10,13-14,17H,5-8,11-12,15-16,18H2,1H3 |
| InChIKey | WSKTVSBIHWPZCM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|