C28H21N5O5 — CID 78427308
1-(1,3-benzodioxol-5-yl)-N-[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]-9-methylpyrido[3,4-b]indole-3-carboxamide (PubChem CID 78427308) has the molecular formula C28H21N5O5 and a molecular weight of 507.51 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]-9-methylpyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]-9-methylpyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 78427308 |
| Molecular Formula | C28H21N5O5 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[(E)-[4-(hydroxycarbamoyl)phenyl]methylideneamino]-9-methylpyrido[3,4-b]indole-3-carboxamide |
| SMILES | Cn1c2ccccc2c2cc(C(=O)N/N=C/c3ccc(C(=O)NO)cc3)nc(-c3ccc4c(c3)OCO4)c21 |
| InChI | InChI=1S/C28H21N5O5/c1-33-22-5-3-2-4-19(22)20-13-21(28(35)31-29-14-16-6-8-17(9-7-16)27(34)32-36)30-25(26(20)33)18-10-11-23-24(12-18)38-15-37-23/h2-14,36H,15H2,1H3,(H,31,35)(H,32,34)/b29-14+ |
| InChIKey | OVYVTZCBSLEISZ-IPPBACCNSA-N |
| XLogP | 4.01 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|