C16H25NO2 — CID 784275
(3S,5S)-1-[(3,4-dimethoxyphenyl)methyl]-3,5-dimethylpiperidine (PubChem CID 784275) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is (3S,5S)-1-[(3,4-dimethoxyphenyl)methyl]-3,5-dimethylpiperidine.
| Compound Name | (3S,5S)-1-[(3,4-dimethoxyphenyl)methyl]-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 784275 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (3S,5S)-1-[(3,4-dimethoxyphenyl)methyl]-3,5-dimethylpiperidine |
| SMILES | COc1ccc(CN2C[C@@H](C)C[C@H](C)C2)cc1OC |
| InChI | InChI=1S/C16H25NO2/c1-12-7-13(2)10-17(9-12)11-14-5-6-15(18-3)16(8-14)19-4/h5-6,8,12-13H,7,9-11H2,1-4H3/t12-,13-/m0/s1 |
| InChIKey | VPYIBXONAYEZTD-STQMWFEESA-N |
| XLogP | 3.18 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |