About 2-azanidylethanolate;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;iron(3+)
2-azanidylethanolate;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;iron(3+) (PubChem CID 78427510) has the molecular formula C14H21FeN2O3
and a molecular weight of 321.18 g/mol. Its IUPAC name is 2-azanidylethanolate;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;iron(3+).
Molecular Properties
| Compound Name | 2-azanidylethanolate;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;iron(3+) |
| PubChem CID | 78427510 |
| Molecular Formula | C14H21FeN2O3 |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-azanidylethanolate;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;iron(3+) |
| SMILES | Cc1cc(C2CCCCC2)n([O-])c(=O)c1.[Fe+3].[NH-]CC[O-] |
| InChI | InChI=1S/C12H16NO2.C2H5NO.Fe/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10;3-1-2-4;/h7-8,10H,2-6H2,1H3;3H,1-2H2;/q-1;-2;+3 |
| InChIKey | DTUWKBDKPGJHPX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 91.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 2-azanidylethanolate;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;iron(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azanidylethanolate;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;iron(3+)?
The IUPAC name of 2-azanidylethanolate;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;iron(3+) (CID 78427510) is 2-azanidylethanolate;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;iron(3+).
What is the SMILES notation for 2-azanidylethanolate;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;iron(3+)?
The canonical SMILES for 2-azanidylethanolate;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;iron(3+) is Cc1cc(C2CCCCC2)n([O-])c(=O)c1.[Fe+3].[NH-]CC[O-].
What is the InChIKey of 2-azanidylethanolate;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;iron(3+)?
The InChIKey is DTUWKBDKPGJHPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16NO2.C2H5NO.Fe/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10;3-1-2-4;/h7-8,10H,2-6H2,1H3;3H,1-2H2;/q-1;-2;+3.
What are the key properties of 2-azanidylethanolate;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;iron(3+)?
2-azanidylethanolate;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;iron(3+) has a molecular weight of 321.18 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azanidylethanolate;6-cyclohexyl-4-methyl-1-oxidopyridin-2-one;iron(3+) is sourced from PubChem (CID 78427510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).