C19H16BrFN4OS2 — CID 78427626
(11-bromo-8,10-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,11-tetraen-5-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 78427626) has the molecular formula C19H16BrFN4OS2 and a molecular weight of 479.40 g/mol. Its IUPAC name is (11-bromo-8,10-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,11-tetraen-5-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | (11-bromo-8,10-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,11-tetraen-5-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 78427626 |
| Molecular Formula | C19H16BrFN4OS2 |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 477.99 |
| IUPAC Name | (11-bromo-8,10-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,11-tetraen-5-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1[nH]nc2c1CSc1sc(Br)cc1-2)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H16BrFN4OS2/c20-15-9-11-16-12(10-27-19(11)28-15)17(23-22-16)18(26)25-7-5-24(6-8-25)14-4-2-1-3-13(14)21/h1-4,9H,5-8,10H2,(H,22,23) |
| InChIKey | RBSGTEYUENESQQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |