C13H20F2N4O7S — CID 78427656
[(2S,5S)-4,4-difluoro-2-[[2-(methylamino)cyclopentyl]oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 78427656) has the molecular formula C13H20F2N4O7S and a molecular weight of 414.39 g/mol. Its IUPAC name is [(2S,5S)-4,4-difluoro-2-[[2-(methylamino)cyclopentyl]oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5S)-4,4-difluoro-2-[[2-(methylamino)cyclopentyl]oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 78427656 |
| Molecular Formula | C13H20F2N4O7S |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | [(2S,5S)-4,4-difluoro-2-[[2-(methylamino)cyclopentyl]oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CNC1CCCC1ONC(=O)[C@@H]1CC(F)(F)[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H20F2N4O7S/c1-16-7-3-2-4-9(7)25-17-11(20)8-5-13(14,15)10-6-18(8)12(21)19(10)26-27(22,23)24/h7-10,16H,2-6H2,1H3,(H,17,20)(H,22,23,24)/t7?,8-,9?,10-/m0/s1 |
| InChIKey | SGCZTFQCQSQYPL-LRHRNSLUSA-N |
| XLogP | -0.58 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|