C12H19F2N5O7S — CID 78427792
[(2S,5S)-2-[(3-aminopyrrolidin-3-yl)methoxycarbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 78427792) has the molecular formula C12H19F2N5O7S and a molecular weight of 415.38 g/mol. Its IUPAC name is [(2S,5S)-2-[(3-aminopyrrolidin-3-yl)methoxycarbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5S)-2-[(3-aminopyrrolidin-3-yl)methoxycarbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 78427792 |
| Molecular Formula | C12H19F2N5O7S |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [(2S,5S)-2-[(3-aminopyrrolidin-3-yl)methoxycarbamoyl]-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC1(CONC(=O)[C@@H]2CC(F)(F)[C@@H]3CN2C(=O)N3OS(=O)(=O)O)CCNC1 |
| InChI | InChI=1S/C12H19F2N5O7S/c13-12(14)3-7(9(20)17-25-6-11(15)1-2-16-5-11)18-4-8(12)19(10(18)21)26-27(22,23)24/h7-8,16H,1-6,15H2,(H,17,20)(H,22,23,24)/t7-,8-,11?/m0/s1 |
| InChIKey | HUSVIKIWXCUEGZ-KHSUWTBESA-N |
| XLogP | -2.03 |
| TPSA | 163.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|