About N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1H-indazol-6-amine
N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1H-indazol-6-amine (PubChem CID 784342) has the molecular formula C15H12N4O4
and a molecular weight of 312.29 g/mol. Its IUPAC name is N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1H-indazol-6-amine.
Molecular Properties
| Compound Name | N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1H-indazol-6-amine |
| PubChem CID | 784342 |
| Molecular Formula | C15H12N4O4 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1H-indazol-6-amine |
| SMILES | O=[N+]([O-])c1cc2c(cc1CNc1ccc3cn[nH]c3c1)OCO2 |
| InChI | InChI=1S/C15H12N4O4/c20-19(21)13-5-15-14(22-8-23-15)3-10(13)6-16-11-2-1-9-7-17-18-12(9)4-11/h1-5,7,16H,6,8H2,(H,17,18) |
| InChIKey | YTVKZOVQSYGTLX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1H-indazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1H-indazol-6-amine?
The IUPAC name of N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1H-indazol-6-amine (CID 784342) is N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1H-indazol-6-amine.
What is the SMILES notation for N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1H-indazol-6-amine?
The canonical SMILES for N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1H-indazol-6-amine is O=[N+]([O-])c1cc2c(cc1CNc1ccc3cn[nH]c3c1)OCO2.
What is the InChIKey of N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1H-indazol-6-amine?
The InChIKey is YTVKZOVQSYGTLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4O4/c20-19(21)13-5-15-14(22-8-23-15)3-10(13)6-16-11-2-1-9-7-17-18-12(9)4-11/h1-5,7,16H,6,8H2,(H,17,18).
What are the key properties of N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1H-indazol-6-amine?
N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1H-indazol-6-amine has a molecular weight of 312.29 g/mol, XLogP of 2.81, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1H-indazol-6-amine is sourced from PubChem (CID 784342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).