C24H21FN2O2S — CID 7843936
3-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethylsulfanyl]quinazolin-4-one (PubChem CID 7843936) has the molecular formula C24H21FN2O2S and a molecular weight of 420.51 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 7843936 |
| Molecular Formula | C24H21FN2O2S |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-2-[2-(4-fluorophenoxy)ethylsulfanyl]quinazolin-4-one |
| SMILES | Cc1ccc(-n2c(SCCOc3ccc(F)cc3)nc3ccccc3c2=O)c(C)c1 |
| InChI | InChI=1S/C24H21FN2O2S/c1-16-7-12-22(17(2)15-16)27-23(28)20-5-3-4-6-21(20)26-24(27)30-14-13-29-19-10-8-18(25)9-11-19/h3-12,15H,13-14H2,1-2H3 |
| InChIKey | SJKIQUIMSCREDJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|