C21H18FNO6 — CID 7844131
[(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate (PubChem CID 7844131) has the molecular formula C21H18FNO6 and a molecular weight of 399.37 g/mol. Its IUPAC name is [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate.
| Compound Name | [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 7844131 |
| Molecular Formula | C21H18FNO6 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)O[C@H](C)C(=O)Nc3ccccc3F)ccc12 |
| InChI | InChI=1S/C21H18FNO6/c1-12-9-19(24)29-18-10-14(7-8-15(12)18)27-11-20(25)28-13(2)21(26)23-17-6-4-3-5-16(17)22/h3-10,13H,11H2,1-2H3,(H,23,26)/t13-/m1/s1 |
| InChIKey | KNKNYCRHMPHRJT-CYBMUJFWSA-N |
| XLogP | 3.19 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|